C15H14N4 — CID 767778
1,5-bis(4-methylphenyl)tetrazole (PubChem CID 767778) has the molecular formula C15H14N4 and a molecular weight of 250.31 g/mol. Its IUPAC name is 1,5-bis(4-methylphenyl)tetrazole.
| Compound Name | 1,5-bis(4-methylphenyl)tetrazole |
|---|---|
| PubChem CID | 767778 |
| Molecular Formula | C15H14N4 |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 1,5-bis(4-methylphenyl)tetrazole |
| SMILES | Cc1ccc(-c2nnnn2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C15H14N4/c1-11-3-7-13(8-4-11)15-16-17-18-19(15)14-9-5-12(2)6-10-14/h3-10H,1-2H3 |
| InChIKey | VKSASTOURDJJGV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |