About 4-(1,3-benzodioxol-5-yl)-2-(2-propyl-4-pyridinyl)-1,3-thiazole
4-(1,3-benzodioxol-5-yl)-2-(2-propyl-4-pyridinyl)-1,3-thiazole (PubChem CID 7677839) has the molecular formula C18H16N2O2S
and a molecular weight of 324.41 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-2-(2-propyl-4-pyridinyl)-1,3-thiazole.
Molecular Properties
| Compound Name | 4-(1,3-benzodioxol-5-yl)-2-(2-propyl-4-pyridinyl)-1,3-thiazole |
| PubChem CID | 7677839 |
| Molecular Formula | C18H16N2O2S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-2-(2-propyl-4-pyridinyl)-1,3-thiazole |
| SMILES | CCCc1cc(-c2nc(-c3ccc4c(c3)OCO4)cs2)ccn1 |
| InChI | InChI=1S/C18H16N2O2S/c1-2-3-14-8-13(6-7-19-14)18-20-15(10-23-18)12-4-5-16-17(9-12)22-11-21-16/h4-10H,2-3,11H2,1H3 |
| InChIKey | CZAXZCYQBLBQPF-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(1,3-benzodioxol-5-yl)-2-(2-propyl-4-pyridinyl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-benzodioxol-5-yl)-2-(2-propyl-4-pyridinyl)-1,3-thiazole?
The IUPAC name of 4-(1,3-benzodioxol-5-yl)-2-(2-propyl-4-pyridinyl)-1,3-thiazole (CID 7677839) is 4-(1,3-benzodioxol-5-yl)-2-(2-propyl-4-pyridinyl)-1,3-thiazole.
What is the SMILES notation for 4-(1,3-benzodioxol-5-yl)-2-(2-propyl-4-pyridinyl)-1,3-thiazole?
The canonical SMILES for 4-(1,3-benzodioxol-5-yl)-2-(2-propyl-4-pyridinyl)-1,3-thiazole is CCCc1cc(-c2nc(-c3ccc4c(c3)OCO4)cs2)ccn1.
What is the InChIKey of 4-(1,3-benzodioxol-5-yl)-2-(2-propyl-4-pyridinyl)-1,3-thiazole?
The InChIKey is CZAXZCYQBLBQPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O2S/c1-2-3-14-8-13(6-7-19-14)18-20-15(10-23-18)12-4-5-16-17(9-12)22-11-21-16/h4-10H,2-3,11H2,1H3.
What are the key properties of 4-(1,3-benzodioxol-5-yl)-2-(2-propyl-4-pyridinyl)-1,3-thiazole?
4-(1,3-benzodioxol-5-yl)-2-(2-propyl-4-pyridinyl)-1,3-thiazole has a molecular weight of 324.41 g/mol, XLogP of 4.55, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-benzodioxol-5-yl)-2-(2-propyl-4-pyridinyl)-1,3-thiazole is sourced from PubChem (CID 7677839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).