C17H16O4 — CID 76780239
6a-methyl-7,11b-dihydro-6H-indeno[2,1-c]chromene-3,9,10-triol (PubChem CID 76780239) has the molecular formula C17H16O4 and a molecular weight of 284.31 g/mol. Its IUPAC name is 6a-methyl-7,11b-dihydro-6H-indeno[2,1-c]chromene-3,9,10-triol.
| Compound Name | 6a-methyl-7,11b-dihydro-6H-indeno[2,1-c]chromene-3,9,10-triol |
|---|---|
| PubChem CID | 76780239 |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 6a-methyl-7,11b-dihydro-6H-indeno[2,1-c]chromene-3,9,10-triol |
| SMILES | CC12COc3cc(O)ccc3C1c1cc(O)c(O)cc1C2 |
| InChI | InChI=1S/C17H16O4/c1-17-7-9-4-13(19)14(20)6-12(9)16(17)11-3-2-10(18)5-15(11)21-8-17/h2-6,16,18-20H,7-8H2,1H3 |
| InChIKey | DITGLACHHCYUPH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|