C21H14Cl2N3O2+ — CID 7678092
4-amino-2-(3,4-dichlorophenyl)-6,7-dihydro-[1,3]benzodioxolo[5,6-a]quinolizin-5-ium-3-carbonitrile (PubChem CID 7678092) has the molecular formula C21H14Cl2N3O2+ and a molecular weight of 411.27 g/mol. Its IUPAC name is 4-amino-2-(3,4-dichlorophenyl)-6,7-dihydro-[1,3]benzodioxolo[5,6-a]quinolizin-5-ium-3-carbonitrile.
| Compound Name | 4-amino-2-(3,4-dichlorophenyl)-6,7-dihydro-[1,3]benzodioxolo[5,6-a]quinolizin-5-ium-3-carbonitrile |
|---|---|
| PubChem CID | 7678092 |
| Molecular Formula | C21H14Cl2N3O2+ |
| Molecular Weight | 411.27 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | 4-amino-2-(3,4-dichlorophenyl)-6,7-dihydro-[1,3]benzodioxolo[5,6-a]quinolizin-5-ium-3-carbonitrile |
| SMILES | N#Cc1c(-c2ccc(Cl)c(Cl)c2)cc2[n+](c1N)CCc1cc3c(cc1-2)OCO3 |
| InChI | InChI=1S/C21H13Cl2N3O2/c22-16-2-1-11(5-17(16)23)13-7-18-14-8-20-19(27-10-28-20)6-12(14)3-4-26(18)21(25)15(13)9-24/h1-2,5-8,25H,3-4,10H2/p+1 |
| InChIKey | ZLLISZZHOJYVMQ-UHFFFAOYSA-O |
| XLogP | 4.35 |
| TPSA | 72.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.27 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|