C24H20F6N6O2 — CID 76781456
2-[[4-oxo-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)but-2-en-2-yl]amino]-2-phenylacetamide (PubChem CID 76781456) has the molecular formula C24H20F6N6O2 and a molecular weight of 538.45 g/mol. Its IUPAC name is 2-[[4-oxo-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)but-2-en-2-yl]amino]-2-phenylacetamide.
| Compound Name | 2-[[4-oxo-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)but-2-en-2-yl]amino]-2-phenylacetamide |
|---|---|
| PubChem CID | 76781456 |
| Molecular Formula | C24H20F6N6O2 |
| Molecular Weight | 538.45 g/mol |
| Exact Mass | 538.16 |
| IUPAC Name | 2-[[4-oxo-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)but-2-en-2-yl]amino]-2-phenylacetamide |
| SMILES | NC(=O)C(NC(=CC(=O)N1CCn2c(nnc2C(F)(F)F)C1)Cc1cc(F)c(F)cc1F)c1ccccc1 |
| InChI | InChI=1S/C24H20F6N6O2/c25-16-11-18(27)17(26)9-14(16)8-15(32-21(22(31)38)13-4-2-1-3-5-13)10-20(37)35-6-7-36-19(12-35)33-34-23(36)24(28,29)30/h1-5,9-11,21,32H,6-8,12H2,(H2,31,38) |
| InChIKey | PKFNIQXTCJPYGT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|