C23H24N2O3S — CID 7678175
(2R,9'S)-3-(4-hydroxyphenyl)-6',9',11',11'-tetramethylspiro[1,3-thiazolidine-2,3'-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene]-2',4-dione (PubChem CID 7678175) has the molecular formula C23H24N2O3S and a molecular weight of 408.52 g/mol. Its IUPAC name is (2R,9'S)-3-(4-hydroxyphenyl)-6',9',11',11'-tetramethylspiro[1,3-thiazolidine-2,3'-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene]-2',4-dione.
| Compound Name | (2R,9'S)-3-(4-hydroxyphenyl)-6',9',11',11'-tetramethylspiro[1,3-thiazolidine-2,3'-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene]-2',4-dione |
|---|---|
| PubChem CID | 7678175 |
| Molecular Formula | C23H24N2O3S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | (2R,9'S)-3-(4-hydroxyphenyl)-6',9',11',11'-tetramethylspiro[1,3-thiazolidine-2,3'-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene]-2',4-dione |
| SMILES | Cc1cc2c3c(c1)[C@@]1(SCC(=O)N1c1ccc(O)cc1)C(=O)N3C(C)(C)C[C@@H]2C |
| InChI | InChI=1S/C23H24N2O3S/c1-13-9-17-14(2)11-22(3,4)25-20(17)18(10-13)23(21(25)28)24(19(27)12-29-23)15-5-7-16(26)8-6-15/h5-10,14,26H,11-12H2,1-4H3/t14-,23+/m0/s1 |
| InChIKey | ULMSZBUACBYOBG-LFVRLGFBSA-N |
| XLogP | 4.27 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |