C26H23F3N4O4S — CID 76782233
5-[[2-[3-[3-(1,3-dioxoisoindol-2-yl)propylamino]pyrrolidin-1-yl]-5-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 76782233) has the molecular formula C26H23F3N4O4S and a molecular weight of 544.56 g/mol. Its IUPAC name is 5-[[2-[3-[3-(1,3-dioxoisoindol-2-yl)propylamino]pyrrolidin-1-yl]-5-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[2-[3-[3-(1,3-dioxoisoindol-2-yl)propylamino]pyrrolidin-1-yl]-5-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 76782233 |
| Molecular Formula | C26H23F3N4O4S |
| Molecular Weight | 544.56 g/mol |
| Exact Mass | 544.14 |
| IUPAC Name | 5-[[2-[3-[3-(1,3-dioxoisoindol-2-yl)propylamino]pyrrolidin-1-yl]-5-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(=Cc2cc(C(F)(F)F)ccc2N2CCC(NCCCN3C(=O)c4ccccc4C3=O)C2)S1 |
| InChI | InChI=1S/C26H23F3N4O4S/c27-26(28,29)16-6-7-20(15(12-16)13-21-22(34)31-25(37)38-21)32-11-8-17(14-32)30-9-3-10-33-23(35)18-4-1-2-5-19(18)24(33)36/h1-2,4-7,12-13,17,30H,3,8-11,14H2,(H,31,34,37) |
| InChIKey | WGEZPNWHQWBCOJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.56 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|