C20H22N4O4 — CID 76785696
N-[4-[2,4,6-trioxo-5-(3-piperidin-1-ylprop-2-enylidene)-1,3-diazinan-1-yl]phenyl]acetamide (PubChem CID 76785696) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is N-[4-[2,4,6-trioxo-5-(3-piperidin-1-ylprop-2-enylidene)-1,3-diazinan-1-yl]phenyl]acetamide.
| Compound Name | N-[4-[2,4,6-trioxo-5-(3-piperidin-1-ylprop-2-enylidene)-1,3-diazinan-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 76785696 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | N-[4-[2,4,6-trioxo-5-(3-piperidin-1-ylprop-2-enylidene)-1,3-diazinan-1-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(N2C(=O)NC(=O)C(=CC=CN3CCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C20H22N4O4/c1-14(25)21-15-7-9-16(10-8-15)24-19(27)17(18(26)22-20(24)28)6-5-13-23-11-3-2-4-12-23/h5-10,13H,2-4,11-12H2,1H3,(H,21,25)(H,22,26,28) |
| InChIKey | QVIKOBHYROLQRZ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|