C30H27N5OS — CID 76788676
8-methyl-5-phenylsulfanyl-4-[(4-pyridin-2-ylphenyl)methyl]-1,4,8,10-tetrazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one (PubChem CID 76788676) has the molecular formula C30H27N5OS and a molecular weight of 505.65 g/mol. Its IUPAC name is 8-methyl-5-phenylsulfanyl-4-[(4-pyridin-2-ylphenyl)methyl]-1,4,8,10-tetrazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one.
| Compound Name | 8-methyl-5-phenylsulfanyl-4-[(4-pyridin-2-ylphenyl)methyl]-1,4,8,10-tetrazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one |
|---|---|
| PubChem CID | 76788676 |
| Molecular Formula | C30H27N5OS |
| Molecular Weight | 505.65 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | 8-methyl-5-phenylsulfanyl-4-[(4-pyridin-2-ylphenyl)methyl]-1,4,8,10-tetrazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one |
| SMILES | CN1C(=O)c2c(cn(Cc3ccc(-c4ccccn4)cc3)c2Sc2ccccc2)N2C1=NC1CCCC12 |
| InChI | InChI=1S/C30H27N5OS/c1-33-28(36)27-26(35-25-12-7-11-24(25)32-30(33)35)19-34(29(27)37-22-8-3-2-4-9-22)18-20-13-15-21(16-14-20)23-10-5-6-17-31-23/h2-6,8-10,13-17,19,24-25H,7,11-12,18H2,1H3 |
| InChIKey | ZVSRORMDDQRCQU-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 53.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.65 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |