C18H19Cl2N3O4 — CID 7678994
cis-(1R,3S)-3-(2,2-dichloroethenyl)-N-[4-(3,4-dimethoxyphenyl)-1,2,5-oxadiazol-3-yl]-2,2-dimethylcyclopropane-1-carboxamide (PubChem CID 7678994) has the molecular formula C18H19Cl2N3O4 and a molecular weight of 412.27 g/mol. Its IUPAC name is cis-(1R,3S)-3-(2,2-dichloroethenyl)-N-[4-(3,4-dimethoxyphenyl)-1,2,5-oxadiazol-3-yl]-2,2-dimethylcyclopropane-1-carboxamide.
| Compound Name | cis-(1R,3S)-3-(2,2-dichloroethenyl)-N-[4-(3,4-dimethoxyphenyl)-1,2,5-oxadiazol-3-yl]-2,2-dimethylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 7678994 |
| Molecular Formula | C18H19Cl2N3O4 |
| Molecular Weight | 412.27 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | cis-(1R,3S)-3-(2,2-dichloroethenyl)-N-[4-(3,4-dimethoxyphenyl)-1,2,5-oxadiazol-3-yl]-2,2-dimethylcyclopropane-1-carboxamide |
| SMILES | COc1ccc(-c2nonc2NC(=O)[C@@H]2[C@@H](C=C(Cl)Cl)C2(C)C)cc1OC |
| InChI | InChI=1S/C18H19Cl2N3O4/c1-18(2)10(8-13(19)20)14(18)17(24)21-16-15(22-27-23-16)9-5-6-11(25-3)12(7-9)26-4/h5-8,10,14H,1-4H3,(H,21,23,24)/t10-,14+/m1/s1 |
| InChIKey | LQTQDGHTAQJPRQ-YGRLFVJLSA-N |
| XLogP | 4.28 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.27 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |