C9H15N3S — CID 767904
4-(piperidin-1-ylmethyl)-1,3-thiazol-2-amine (PubChem CID 767904) has the molecular formula C9H15N3S and a molecular weight of 197.31 g/mol. Its IUPAC name is 4-(piperidin-1-ylmethyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(piperidin-1-ylmethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 767904 |
| Molecular Formula | C9H15N3S |
| Molecular Weight | 197.31 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 4-(piperidin-1-ylmethyl)-1,3-thiazol-2-amine |
| SMILES | Nc1nc(CN2CCCCC2)cs1 |
| InChI | InChI=1S/C9H15N3S/c10-9-11-8(7-13-9)6-12-4-2-1-3-5-12/h7H,1-6H2,(H2,10,11) |
| InChIKey | HHQPZGLNMNUGFQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.31 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |