C13H20Cl2N5O4P — CID 76794085
1,3-bis(2-chloroethyl)-2-[3-(1-methyl-5-nitroimidazol-2-yl)prop-2-enoxy]-1,3,2λ5-diazaphospholidine 2-oxide (PubChem CID 76794085) has the molecular formula C13H20Cl2N5O4P and a molecular weight of 412.21 g/mol. Its IUPAC name is 1,3-bis(2-chloroethyl)-2-[3-(1-methyl-5-nitroimidazol-2-yl)prop-2-enoxy]-1,3,2λ5-diazaphospholidine 2-oxide.
| Compound Name | 1,3-bis(2-chloroethyl)-2-[3-(1-methyl-5-nitroimidazol-2-yl)prop-2-enoxy]-1,3,2λ5-diazaphospholidine 2-oxide |
|---|---|
| PubChem CID | 76794085 |
| Molecular Formula | C13H20Cl2N5O4P |
| Molecular Weight | 412.21 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | 1,3-bis(2-chloroethyl)-2-[3-(1-methyl-5-nitroimidazol-2-yl)prop-2-enoxy]-1,3,2λ5-diazaphospholidine 2-oxide |
| SMILES | Cn1c([N+](=O)[O-])cnc1C=CCOP1(=O)N(CCCl)CCN1CCCl |
| InChI | InChI=1S/C13H20Cl2N5O4P/c1-17-12(16-11-13(17)20(21)22)3-2-10-24-25(23)18(6-4-14)8-9-19(25)7-5-15/h2-3,11H,4-10H2,1H3 |
| InChIKey | NPONPMGNFYTISS-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 93.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.21 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|