About 4,6-dichloro-N-[4-(2,6-difluorophenyl)phenyl]-N-(2-hydroxypropyl)pyrimidine-5-carboxamide
4,6-dichloro-N-[4-(2,6-difluorophenyl)phenyl]-N-(2-hydroxypropyl)pyrimidine-5-carboxamide (PubChem CID 76794240) has the molecular formula C20H15Cl2F2N3O2
and a molecular weight of 438.26 g/mol. Its IUPAC name is 4,6-dichloro-N-[4-(2,6-difluorophenyl)phenyl]-N-(2-hydroxypropyl)pyrimidine-5-carboxamide.
Molecular Properties
| Compound Name | 4,6-dichloro-N-[4-(2,6-difluorophenyl)phenyl]-N-(2-hydroxypropyl)pyrimidine-5-carboxamide |
| PubChem CID | 76794240 |
| Molecular Formula | C20H15Cl2F2N3O2 |
| Molecular Weight | 438.26 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | 4,6-dichloro-N-[4-(2,6-difluorophenyl)phenyl]-N-(2-hydroxypropyl)pyrimidine-5-carboxamide |
| SMILES | CC(O)CN(C(=O)c1c(Cl)ncnc1Cl)c1ccc(-c2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C20H15Cl2F2N3O2/c1-11(28)9-27(20(29)17-18(21)25-10-26-19(17)22)13-7-5-12(6-8-13)16-14(23)3-2-4-15(16)24/h2-8,10-11,28H,9H2,1H3 |
| InChIKey | QWEJBYBNWAHPRN-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.26 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,6-dichloro-N-[4-(2,6-difluorophenyl)phenyl]-N-(2-hydroxypropyl)pyrimidine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dichloro-N-[4-(2,6-difluorophenyl)phenyl]-N-(2-hydroxypropyl)pyrimidine-5-carboxamide?
The IUPAC name of 4,6-dichloro-N-[4-(2,6-difluorophenyl)phenyl]-N-(2-hydroxypropyl)pyrimidine-5-carboxamide (CID 76794240) is 4,6-dichloro-N-[4-(2,6-difluorophenyl)phenyl]-N-(2-hydroxypropyl)pyrimidine-5-carboxamide.
What is the SMILES notation for 4,6-dichloro-N-[4-(2,6-difluorophenyl)phenyl]-N-(2-hydroxypropyl)pyrimidine-5-carboxamide?
The canonical SMILES for 4,6-dichloro-N-[4-(2,6-difluorophenyl)phenyl]-N-(2-hydroxypropyl)pyrimidine-5-carboxamide is CC(O)CN(C(=O)c1c(Cl)ncnc1Cl)c1ccc(-c2c(F)cccc2F)cc1.
What is the InChIKey of 4,6-dichloro-N-[4-(2,6-difluorophenyl)phenyl]-N-(2-hydroxypropyl)pyrimidine-5-carboxamide?
The InChIKey is QWEJBYBNWAHPRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15Cl2F2N3O2/c1-11(28)9-27(20(29)17-18(21)25-10-26-19(17)22)13-7-5-12(6-8-13)16-14(23)3-2-4-15(16)24/h2-8,10-11,28H,9H2,1H3.
What are the key properties of 4,6-dichloro-N-[4-(2,6-difluorophenyl)phenyl]-N-(2-hydroxypropyl)pyrimidine-5-carboxamide?
4,6-dichloro-N-[4-(2,6-difluorophenyl)phenyl]-N-(2-hydroxypropyl)pyrimidine-5-carboxamide has a molecular weight of 438.26 g/mol, XLogP of 4.76, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dichloro-N-[4-(2,6-difluorophenyl)phenyl]-N-(2-hydroxypropyl)pyrimidine-5-carboxamide is sourced from PubChem (CID 76794240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).