C17H16FN3O — CID 76794791
8-(2-fluoro-4-pyridinyl)spiro[2,4-dihydro-1H-naphthalene-3,4'-5H-1,3-oxazole]-2'-amine (PubChem CID 76794791) has the molecular formula C17H16FN3O and a molecular weight of 297.33 g/mol. Its IUPAC name is 8-(2-fluoro-4-pyridinyl)spiro[2,4-dihydro-1H-naphthalene-3,4'-5H-1,3-oxazole]-2'-amine.
| Compound Name | 8-(2-fluoro-4-pyridinyl)spiro[2,4-dihydro-1H-naphthalene-3,4'-5H-1,3-oxazole]-2'-amine |
|---|---|
| PubChem CID | 76794791 |
| Molecular Formula | C17H16FN3O |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 8-(2-fluoro-4-pyridinyl)spiro[2,4-dihydro-1H-naphthalene-3,4'-5H-1,3-oxazole]-2'-amine |
| SMILES | NC1=NC2(CCc3c(cccc3-c3ccnc(F)c3)C2)CO1 |
| InChI | InChI=1S/C17H16FN3O/c18-15-8-11(5-7-20-15)13-3-1-2-12-9-17(6-4-14(12)13)10-22-16(19)21-17/h1-3,5,7-8H,4,6,9-10H2,(H2,19,21) |
| InChIKey | SXXADDDVYYYOCL-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|