C36H32ClN2O5+ — CID 76796709
3-[2-[5-[6-chloro-3-(2-formyloxyethyl)-1,3-benzoxazol-3-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethylphenanthro[9,10-b]pyrrol-1-yl]propanoic acid (PubChem CID 76796709) has the molecular formula C36H32ClN2O5+ and a molecular weight of 608.11 g/mol. Its IUPAC name is 3-[2-[5-[6-chloro-3-(2-formyloxyethyl)-1,3-benzoxazol-3-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethylphenanthro[9,10-b]pyrrol-1-yl]propanoic acid.
| Compound Name | 3-[2-[5-[6-chloro-3-(2-formyloxyethyl)-1,3-benzoxazol-3-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethylphenanthro[9,10-b]pyrrol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 76796709 |
| Molecular Formula | C36H32ClN2O5+ |
| Molecular Weight | 608.11 g/mol |
| Exact Mass | 607.20 |
| IUPAC Name | 3-[2-[5-[6-chloro-3-(2-formyloxyethyl)-1,3-benzoxazol-3-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethylphenanthro[9,10-b]pyrrol-1-yl]propanoic acid |
| SMILES | CC1(C)C(=CC=CC=Cc2oc3cc(Cl)ccc3[n+]2CCOC=O)N(CCC(=O)O)c2c1c1ccccc1c1ccccc21 |
| InChI | InChI=1S/C36H31ClN2O5/c1-36(2)31(14-4-3-5-15-32-38(20-21-43-23-40)29-17-16-24(37)22-30(29)44-32)39(19-18-33(41)42)35-28-13-9-7-11-26(28)25-10-6-8-12-27(25)34(35)36/h3-17,22-23H,18-21H2,1-2H3/p+1 |
| InChIKey | BVOLFIXDVYCRNN-UHFFFAOYSA-O |
| XLogP | 7.58 |
| TPSA | 83.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.11 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|