C11H19N9 — CID 767982
6-N-ethyl-2-N-methyl-4-N-propan-2-yl-2-N-(1,2,4-triazol-4-yl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 767982) has the molecular formula C11H19N9 and a molecular weight of 277.34 g/mol. Its IUPAC name is 6-N-ethyl-2-N-methyl-4-N-propan-2-yl-2-N-(1,2,4-triazol-4-yl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-ethyl-2-N-methyl-4-N-propan-2-yl-2-N-(1,2,4-triazol-4-yl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 767982 |
| Molecular Formula | C11H19N9 |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 6-N-ethyl-2-N-methyl-4-N-propan-2-yl-2-N-(1,2,4-triazol-4-yl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCNc1nc(NC(C)C)nc(N(C)n2cnnc2)n1 |
| InChI | InChI=1S/C11H19N9/c1-5-12-9-16-10(15-8(2)3)18-11(17-9)19(4)20-6-13-14-7-20/h6-8H,5H2,1-4H3,(H2,12,15,16,17,18) |
| InChIKey | IKATXSNUCPRIOG-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |