C12H19N7 — CID 767998
6-(3,5-dimethylpyrazol-1-yl)-2-N,2-N,4-N,4-N-tetramethyl-1,3,5-triazine-2,4-diamine (PubChem CID 767998) has the molecular formula C12H19N7 and a molecular weight of 261.33 g/mol. Its IUPAC name is 6-(3,5-dimethylpyrazol-1-yl)-2-N,2-N,4-N,4-N-tetramethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(3,5-dimethylpyrazol-1-yl)-2-N,2-N,4-N,4-N-tetramethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 767998 |
| Molecular Formula | C12H19N7 |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 6-(3,5-dimethylpyrazol-1-yl)-2-N,2-N,4-N,4-N-tetramethyl-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1cc(C)n(-c2nc(N(C)C)nc(N(C)C)n2)n1 |
| InChI | InChI=1S/C12H19N7/c1-8-7-9(2)19(16-8)12-14-10(17(3)4)13-11(15-12)18(5)6/h7H,1-6H3 |
| InChIKey | YPTBSTZVTQBWNC-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 62.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |