C23H25N5O3 — CID 7680054
5-[2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-1-phenylpyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 7680054) has the molecular formula C23H25N5O3 and a molecular weight of 419.49 g/mol. Its IUPAC name is 5-[2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-1-phenylpyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 5-[2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-1-phenylpyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 7680054 |
| Molecular Formula | C23H25N5O3 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 5-[2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-1-phenylpyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | COCCCn1c(C)cc(C(=O)Cn2cnc3c(cnn3-c3ccccc3)c2=O)c1C |
| InChI | InChI=1S/C23H25N5O3/c1-16-12-19(17(2)27(16)10-7-11-31-3)21(29)14-26-15-24-22-20(23(26)30)13-25-28(22)18-8-5-4-6-9-18/h4-6,8-9,12-13,15H,7,10-11,14H2,1-3H3 |
| InChIKey | VGPFLSZEPOVVNI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 83.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|