C24H22F4N4OS — CID 76801224
1-N-[5-(3-fluoroisoquinolin-6-yl)-1,3-thiazol-2-yl]-4-methoxy-3-[4-(trifluoromethyl)phenyl]butane-1,2-diamine (PubChem CID 76801224) has the molecular formula C24H22F4N4OS and a molecular weight of 490.53 g/mol. Its IUPAC name is 1-N-[5-(3-fluoroisoquinolin-6-yl)-1,3-thiazol-2-yl]-4-methoxy-3-[4-(trifluoromethyl)phenyl]butane-1,2-diamine.
| Compound Name | 1-N-[5-(3-fluoroisoquinolin-6-yl)-1,3-thiazol-2-yl]-4-methoxy-3-[4-(trifluoromethyl)phenyl]butane-1,2-diamine |
|---|---|
| PubChem CID | 76801224 |
| Molecular Formula | C24H22F4N4OS |
| Molecular Weight | 490.53 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | 1-N-[5-(3-fluoroisoquinolin-6-yl)-1,3-thiazol-2-yl]-4-methoxy-3-[4-(trifluoromethyl)phenyl]butane-1,2-diamine |
| SMILES | COCC(c1ccc(C(F)(F)F)cc1)C(N)CNc1ncc(-c2ccc3cnc(F)cc3c2)s1 |
| InChI | InChI=1S/C24H22F4N4OS/c1-33-13-19(14-4-6-18(7-5-14)24(26,27)28)20(29)11-31-23-32-12-21(34-23)15-2-3-16-10-30-22(25)9-17(16)8-15/h2-10,12,19-20H,11,13,29H2,1H3,(H,31,32) |
| InChIKey | LSPOYQTVDNCDIB-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.53 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|