About 3-methoxy-6-methyl-2-propan-2-yl-2,5-dihydropyrazine
3-methoxy-6-methyl-2-propan-2-yl-2,5-dihydropyrazine (PubChem CID 76801257) has the molecular formula C9H16N2O
and a molecular weight of 168.24 g/mol. Its IUPAC name is 3-methoxy-6-methyl-2-propan-2-yl-2,5-dihydropyrazine.
Molecular Properties
| Compound Name | 3-methoxy-6-methyl-2-propan-2-yl-2,5-dihydropyrazine |
| PubChem CID | 76801257 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 3-methoxy-6-methyl-2-propan-2-yl-2,5-dihydropyrazine |
| SMILES | COC1=NCC(C)=NC1C(C)C |
| InChI | InChI=1S/C9H16N2O/c1-6(2)8-9(12-4)10-5-7(3)11-8/h6,8H,5H2,1-4H3 |
| InChIKey | SXNAFTODZAMIKY-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methoxy-6-methyl-2-propan-2-yl-2,5-dihydropyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-6-methyl-2-propan-2-yl-2,5-dihydropyrazine?
The IUPAC name of 3-methoxy-6-methyl-2-propan-2-yl-2,5-dihydropyrazine (CID 76801257) is 3-methoxy-6-methyl-2-propan-2-yl-2,5-dihydropyrazine.
What is the SMILES notation for 3-methoxy-6-methyl-2-propan-2-yl-2,5-dihydropyrazine?
The canonical SMILES for 3-methoxy-6-methyl-2-propan-2-yl-2,5-dihydropyrazine is COC1=NCC(C)=NC1C(C)C.
What is the InChIKey of 3-methoxy-6-methyl-2-propan-2-yl-2,5-dihydropyrazine?
The InChIKey is SXNAFTODZAMIKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O/c1-6(2)8-9(12-4)10-5-7(3)11-8/h6,8H,5H2,1-4H3.
What are the key properties of 3-methoxy-6-methyl-2-propan-2-yl-2,5-dihydropyrazine?
3-methoxy-6-methyl-2-propan-2-yl-2,5-dihydropyrazine has a molecular weight of 168.24 g/mol, XLogP of 1.53, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-6-methyl-2-propan-2-yl-2,5-dihydropyrazine is sourced from PubChem (CID 76801257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).