C18H19Cl2N5O3S — CID 76805532
N-[1-[5-(3-aminophenoxy)-4-ethyl-1,2,4-triazol-3-yl]ethyl]-3,4-dichlorobenzenesulfonamide (PubChem CID 76805532) has the molecular formula C18H19Cl2N5O3S and a molecular weight of 456.36 g/mol. Its IUPAC name is N-[1-[5-(3-aminophenoxy)-4-ethyl-1,2,4-triazol-3-yl]ethyl]-3,4-dichlorobenzenesulfonamide.
| Compound Name | N-[1-[5-(3-aminophenoxy)-4-ethyl-1,2,4-triazol-3-yl]ethyl]-3,4-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 76805532 |
| Molecular Formula | C18H19Cl2N5O3S |
| Molecular Weight | 456.36 g/mol |
| Exact Mass | 455.06 |
| IUPAC Name | N-[1-[5-(3-aminophenoxy)-4-ethyl-1,2,4-triazol-3-yl]ethyl]-3,4-dichlorobenzenesulfonamide |
| SMILES | CCn1c(Oc2cccc(N)c2)nnc1C(C)NS(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H19Cl2N5O3S/c1-3-25-17(22-23-18(25)28-13-6-4-5-12(21)9-13)11(2)24-29(26,27)14-7-8-15(19)16(20)10-14/h4-11,24H,3,21H2,1-2H3 |
| InChIKey | GTHUPESAJNWKMP-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.36 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|