sodium hept-2-ene-1-sulfonate

C7H13NaO3S — CID 76806236

IUPACsodium hept-2-ene-1-sulfonate
SMILESCCCCC=CCS(=O)(=O)[O-].[Na+]
InChIInChI=1S/C7H14O3S.Na/c1-2-3-4-5-6-7-11(8,9)10;/h5-6H,2-4,7H2,1H3,(H,8,9,10);/q;+1/p-1
InChIKeyDXLLPWOGQRYVPE-UHFFFAOYSA-M
MW200.23 g/mol
LogP-1.72
Rot. Bonds5

About sodium hept-2-ene-1-sulfonate

sodium hept-2-ene-1-sulfonate (PubChem CID 76806236) has the molecular formula C7H13NaO3S and a molecular weight of 200.23 g/mol. Its IUPAC name is sodium hept-2-ene-1-sulfonate.

Molecular Properties

Compound Namesodium hept-2-ene-1-sulfonate
PubChem CID76806236
Molecular FormulaC7H13NaO3S
Molecular Weight200.23 g/mol
Exact Mass200.05
IUPAC Namesodium hept-2-ene-1-sulfonate
SMILESCCCCC=CCS(=O)(=O)[O-].[Na+]
InChIInChI=1S/C7H14O3S.Na/c1-2-3-4-5-6-7-11(8,9)10;/h5-6H,2-4,7H2,1H3,(H,8,9,10);/q;+1/p-1
InChIKeyDXLLPWOGQRYVPE-UHFFFAOYSA-M
XLogP-1.72
TPSA57.20 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.23
LogP ≤ 5-1.72
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze sodium hept-2-ene-1-sulfonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium hept-2-ene-1-sulfonate?
The IUPAC name of sodium hept-2-ene-1-sulfonate (CID 76806236) is sodium hept-2-ene-1-sulfonate.
What is the SMILES notation for sodium hept-2-ene-1-sulfonate?
The canonical SMILES for sodium hept-2-ene-1-sulfonate is CCCCC=CCS(=O)(=O)[O-].[Na+].
What is the InChIKey of sodium hept-2-ene-1-sulfonate?
The InChIKey is DXLLPWOGQRYVPE-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H14O3S.Na/c1-2-3-4-5-6-7-11(8,9)10;/h5-6H,2-4,7H2,1H3,(H,8,9,10);/q;+1/p-1.
What are the key properties of sodium hept-2-ene-1-sulfonate?
sodium hept-2-ene-1-sulfonate has a molecular weight of 200.23 g/mol, XLogP of -1.72, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium hept-2-ene-1-sulfonate is sourced from PubChem (CID 76806236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).