C28H24N6O — CID 76806536
5-[(4-methylphenyl)methyl]-11-[(4-phenylphenyl)methyl]-3,5,7,9,11,13-hexazatricyclo[8.3.0.02,6]trideca-1(10),2(6),8,12-tetraen-4-one (PubChem CID 76806536) has the molecular formula C28H24N6O and a molecular weight of 460.54 g/mol. Its IUPAC name is 5-[(4-methylphenyl)methyl]-11-[(4-phenylphenyl)methyl]-3,5,7,9,11,13-hexazatricyclo[8.3.0.02,6]trideca-1(10),2(6),8,12-tetraen-4-one.
| Compound Name | 5-[(4-methylphenyl)methyl]-11-[(4-phenylphenyl)methyl]-3,5,7,9,11,13-hexazatricyclo[8.3.0.02,6]trideca-1(10),2(6),8,12-tetraen-4-one |
|---|---|
| PubChem CID | 76806536 |
| Molecular Formula | C28H24N6O |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | 5-[(4-methylphenyl)methyl]-11-[(4-phenylphenyl)methyl]-3,5,7,9,11,13-hexazatricyclo[8.3.0.02,6]trideca-1(10),2(6),8,12-tetraen-4-one |
| SMILES | Cc1ccc(Cn2c3c([nH]c2=O)-c2ncn(Cc4ccc(-c5ccccc5)cc4)c2N=CN3)cc1 |
| InChI | InChI=1S/C28H24N6O/c1-19-7-9-21(10-8-19)16-34-27-25(32-28(34)35)24-26(29-17-30-27)33(18-31-24)15-20-11-13-23(14-12-20)22-5-3-2-4-6-22/h2-14,17-18H,15-16H2,1H3,(H,29,30)(H,32,35) |
| InChIKey | DRSRVIUGWKBJCB-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |