About 3-[5-(2,4-dichlorophenyl)-2-ethylphenyl]-4-hydroxybicyclo[3.2.1]octa-3,6-dien-2-one
3-[5-(2,4-dichlorophenyl)-2-ethylphenyl]-4-hydroxybicyclo[3.2.1]octa-3,6-dien-2-one (PubChem CID 76807956) has the molecular formula C22H18Cl2O2
and a molecular weight of 385.29 g/mol. Its IUPAC name is 3-[5-(2,4-dichlorophenyl)-2-ethylphenyl]-4-hydroxybicyclo[3.2.1]octa-3,6-dien-2-one.
Molecular Properties
| Compound Name | 3-[5-(2,4-dichlorophenyl)-2-ethylphenyl]-4-hydroxybicyclo[3.2.1]octa-3,6-dien-2-one |
| PubChem CID | 76807956 |
| Molecular Formula | C22H18Cl2O2 |
| Molecular Weight | 385.29 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | 3-[5-(2,4-dichlorophenyl)-2-ethylphenyl]-4-hydroxybicyclo[3.2.1]octa-3,6-dien-2-one |
| SMILES | CCc1ccc(-c2ccc(Cl)cc2Cl)cc1C1=C(O)C2C=CC(C2)C1=O |
| InChI | InChI=1S/C22H18Cl2O2/c1-2-12-3-4-13(17-8-7-16(23)11-19(17)24)10-18(12)20-21(25)14-5-6-15(9-14)22(20)26/h3-8,10-11,14-15,25H,2,9H2,1H3 |
| InChIKey | QGEXJKSEPULFCM-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.29 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[5-(2,4-dichlorophenyl)-2-ethylphenyl]-4-hydroxybicyclo[3.2.1]octa-3,6-dien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(2,4-dichlorophenyl)-2-ethylphenyl]-4-hydroxybicyclo[3.2.1]octa-3,6-dien-2-one?
The IUPAC name of 3-[5-(2,4-dichlorophenyl)-2-ethylphenyl]-4-hydroxybicyclo[3.2.1]octa-3,6-dien-2-one (CID 76807956) is 3-[5-(2,4-dichlorophenyl)-2-ethylphenyl]-4-hydroxybicyclo[3.2.1]octa-3,6-dien-2-one.
What is the SMILES notation for 3-[5-(2,4-dichlorophenyl)-2-ethylphenyl]-4-hydroxybicyclo[3.2.1]octa-3,6-dien-2-one?
The canonical SMILES for 3-[5-(2,4-dichlorophenyl)-2-ethylphenyl]-4-hydroxybicyclo[3.2.1]octa-3,6-dien-2-one is CCc1ccc(-c2ccc(Cl)cc2Cl)cc1C1=C(O)C2C=CC(C2)C1=O.
What is the InChIKey of 3-[5-(2,4-dichlorophenyl)-2-ethylphenyl]-4-hydroxybicyclo[3.2.1]octa-3,6-dien-2-one?
The InChIKey is QGEXJKSEPULFCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18Cl2O2/c1-2-12-3-4-13(17-8-7-16(23)11-19(17)24)10-18(12)20-21(25)14-5-6-15(9-14)22(20)26/h3-8,10-11,14-15,25H,2,9H2,1H3.
What are the key properties of 3-[5-(2,4-dichlorophenyl)-2-ethylphenyl]-4-hydroxybicyclo[3.2.1]octa-3,6-dien-2-one?
3-[5-(2,4-dichlorophenyl)-2-ethylphenyl]-4-hydroxybicyclo[3.2.1]octa-3,6-dien-2-one has a molecular weight of 385.29 g/mol, XLogP of 6.27, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(2,4-dichlorophenyl)-2-ethylphenyl]-4-hydroxybicyclo[3.2.1]octa-3,6-dien-2-one is sourced from PubChem (CID 76807956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).