C27H38NOP — CID 76808296
[2-(4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)-2-methylpropyl]-bis(3,5-dimethylphenyl)phosphane (PubChem CID 76808296) has the molecular formula C27H38NOP and a molecular weight of 423.58 g/mol. Its IUPAC name is [2-(4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)-2-methylpropyl]-bis(3,5-dimethylphenyl)phosphane.
| Compound Name | [2-(4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)-2-methylpropyl]-bis(3,5-dimethylphenyl)phosphane |
|---|---|
| PubChem CID | 76808296 |
| Molecular Formula | C27H38NOP |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.27 |
| IUPAC Name | [2-(4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)-2-methylpropyl]-bis(3,5-dimethylphenyl)phosphane |
| SMILES | Cc1cc(C)cc(P(CC(C)(C)C2=NC(C(C)(C)C)CO2)c2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C27H38NOP/c1-18-10-19(2)13-22(12-18)30(23-14-20(3)11-21(4)15-23)17-27(8,9)25-28-24(16-29-25)26(5,6)7/h10-15,24H,16-17H2,1-9H3 |
| InChIKey | PMPKVRNMUPNXBM-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|