About 9-trimethylsilylnon-2-en-6,8-diynal
9-trimethylsilylnon-2-en-6,8-diynal (PubChem CID 76808617) has the molecular formula C12H16OSi
and a molecular weight of 204.34 g/mol. Its IUPAC name is 9-trimethylsilylnon-2-en-6,8-diynal.
Molecular Properties
| Compound Name | 9-trimethylsilylnon-2-en-6,8-diynal |
| PubChem CID | 76808617 |
| Molecular Formula | C12H16OSi |
| Molecular Weight | 204.34 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 9-trimethylsilylnon-2-en-6,8-diynal |
| SMILES | C[Si](C)(C)C#CC#CCCC=CC=O |
| InChI | InChI=1S/C12H16OSi/c1-14(2,3)12-10-8-6-4-5-7-9-11-13/h7,9,11H,4-5H2,1-3H3 |
| InChIKey | LXECAQSBJQXKQT-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 9-trimethylsilylnon-2-en-6,8-diynal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-trimethylsilylnon-2-en-6,8-diynal?
The IUPAC name of 9-trimethylsilylnon-2-en-6,8-diynal (CID 76808617) is 9-trimethylsilylnon-2-en-6,8-diynal.
What is the SMILES notation for 9-trimethylsilylnon-2-en-6,8-diynal?
The canonical SMILES for 9-trimethylsilylnon-2-en-6,8-diynal is C[Si](C)(C)C#CC#CCCC=CC=O.
What is the InChIKey of 9-trimethylsilylnon-2-en-6,8-diynal?
The InChIKey is LXECAQSBJQXKQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16OSi/c1-14(2,3)12-10-8-6-4-5-7-9-11-13/h7,9,11H,4-5H2,1-3H3.
What are the key properties of 9-trimethylsilylnon-2-en-6,8-diynal?
9-trimethylsilylnon-2-en-6,8-diynal has a molecular weight of 204.34 g/mol, XLogP of 2.41, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-trimethylsilylnon-2-en-6,8-diynal is sourced from PubChem (CID 76808617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).