C43H45F3N3O2S+ — CID 76810930
1,1,1-trifluoro-N-methyl-N-[1-[2-(1-pentylquinolin-1-ium-2-yl)ethenyl]-3-[2-(1-pentylquinolin-2-ylidene)ethylidene]inden-2-yl]methanesulfonamide (PubChem CID 76810930) has the molecular formula C43H45F3N3O2S+ and a molecular weight of 724.91 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-methyl-N-[1-[2-(1-pentylquinolin-1-ium-2-yl)ethenyl]-3-[2-(1-pentylquinolin-2-ylidene)ethylidene]inden-2-yl]methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-methyl-N-[1-[2-(1-pentylquinolin-1-ium-2-yl)ethenyl]-3-[2-(1-pentylquinolin-2-ylidene)ethylidene]inden-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 76810930 |
| Molecular Formula | C43H45F3N3O2S+ |
| Molecular Weight | 724.91 g/mol |
| Exact Mass | 724.32 |
| IUPAC Name | 1,1,1-trifluoro-N-methyl-N-[1-[2-(1-pentylquinolin-1-ium-2-yl)ethenyl]-3-[2-(1-pentylquinolin-2-ylidene)ethylidene]inden-2-yl]methanesulfonamide |
| SMILES | CCCCCN1C(=CC=C2C(N(C)S(=O)(=O)C(F)(F)F)=C(C=Cc3ccc4ccccc4[n+]3CCCCC)c3ccccc32)C=Cc2ccccc21 |
| InChI | InChI=1S/C43H45F3N3O2S/c1-4-6-14-30-48-34(24-22-32-16-8-12-20-40(32)48)26-28-38-36-18-10-11-19-37(36)39(42(38)47(3)52(50,51)43(44,45)46)29-27-35-25-23-33-17-9-13-21-41(33)49(35)31-15-7-5-2/h8-13,16-29H,4-7,14-15,30-31H2,1-3H3/q+1 |
| InChIKey | LOSXISNWGWHTSB-UHFFFAOYSA-N |
| XLogP | 10.53 |
| TPSA | 44.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.91 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|