C26H45N9O5 — CID 76813103
2-[[5-[(8-amino-3,6,10,13,15,18-hexazabicyclo[6.6.4]octadecan-1-yl)amino]-5-oxopentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 76813103) has the molecular formula C26H45N9O5 and a molecular weight of 563.70 g/mol. Its IUPAC name is 2-[[5-[(8-amino-3,6,10,13,15,18-hexazabicyclo[6.6.4]octadecan-1-yl)amino]-5-oxopentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | 2-[[5-[(8-amino-3,6,10,13,15,18-hexazabicyclo[6.6.4]octadecan-1-yl)amino]-5-oxopentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 76813103 |
| Molecular Formula | C26H45N9O5 |
| Molecular Weight | 563.70 g/mol |
| Exact Mass | 563.35 |
| IUPAC Name | 2-[[5-[(8-amino-3,6,10,13,15,18-hexazabicyclo[6.6.4]octadecan-1-yl)amino]-5-oxopentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | NC12CNCCNCC(NC(=O)CCCC(=O)NC(Cc3ccc(O)cc3)C(=O)O)(CNCCNC1)NCCN2 |
| InChI | InChI=1S/C26H45N9O5/c27-25-15-28-8-10-30-17-26(33-13-12-32-25,18-31-11-9-29-16-25)35-23(38)3-1-2-22(37)34-21(24(39)40)14-19-4-6-20(36)7-5-19/h4-7,21,28-33,36H,1-3,8-18,27H2,(H,34,37)(H,35,38)(H,39,40) |
| InChIKey | PFBUMTNMBQXKII-UHFFFAOYSA-N |
| XLogP | -3.29 |
| TPSA | 213.93 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.70 |
| LogP ≤ 5 | -3.29 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 11 |