C18H17ClO4 — CID 7681322
[(E)-3-phenylprop-2-enyl] 3-chloro-4,5-dimethoxybenzoate (PubChem CID 7681322) has the molecular formula C18H17ClO4 and a molecular weight of 332.78 g/mol. Its IUPAC name is [(E)-3-phenylprop-2-enyl] 3-chloro-4,5-dimethoxybenzoate.
| Compound Name | [(E)-3-phenylprop-2-enyl] 3-chloro-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 7681322 |
| Molecular Formula | C18H17ClO4 |
| Molecular Weight | 332.78 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | [(E)-3-phenylprop-2-enyl] 3-chloro-4,5-dimethoxybenzoate |
| SMILES | COc1cc(C(=O)OC/C=C/c2ccccc2)cc(Cl)c1OC |
| InChI | InChI=1S/C18H17ClO4/c1-21-16-12-14(11-15(19)17(16)22-2)18(20)23-10-6-9-13-7-4-3-5-8-13/h3-9,11-12H,10H2,1-2H3/b9-6+ |
| InChIKey | CXOURCGQWDOMBS-RMKNXTFCSA-N |
| XLogP | 4.23 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.78 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |