C12H16FN3O4 — CID 76815647
N-[1-(5-ethyl-3-fluoro-4-hydroxyoxolan-2-yl)-2-oxopyrimidin-4-yl]acetamide (PubChem CID 76815647) has the molecular formula C12H16FN3O4 and a molecular weight of 285.28 g/mol. Its IUPAC name is N-[1-(5-ethyl-3-fluoro-4-hydroxyoxolan-2-yl)-2-oxopyrimidin-4-yl]acetamide.
| Compound Name | N-[1-(5-ethyl-3-fluoro-4-hydroxyoxolan-2-yl)-2-oxopyrimidin-4-yl]acetamide |
|---|---|
| PubChem CID | 76815647 |
| Molecular Formula | C12H16FN3O4 |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | N-[1-(5-ethyl-3-fluoro-4-hydroxyoxolan-2-yl)-2-oxopyrimidin-4-yl]acetamide |
| SMILES | CCC1OC(n2ccc(NC(C)=O)nc2=O)C(F)C1O |
| InChI | InChI=1S/C12H16FN3O4/c1-3-7-10(18)9(13)11(20-7)16-5-4-8(14-6(2)17)15-12(16)19/h4-5,7,9-11,18H,3H2,1-2H3,(H,14,15,17,19) |
| InChIKey | OUTJYPKEGZJJNA-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |