C14H21N3O3 — CID 7681958
[(Z)-(2,4-dipropoxyphenyl)methylideneamino]urea (PubChem CID 7681958) has the molecular formula C14H21N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is [(Z)-(2,4-dipropoxyphenyl)methylideneamino]urea.
| Compound Name | [(Z)-(2,4-dipropoxyphenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 7681958 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | [(Z)-(2,4-dipropoxyphenyl)methylideneamino]urea |
| SMILES | CCCOc1ccc(/C=N\NC(N)=O)c(OCCC)c1 |
| InChI | InChI=1S/C14H21N3O3/c1-3-7-19-12-6-5-11(10-16-17-14(15)18)13(9-12)20-8-4-2/h5-6,9-10H,3-4,7-8H2,1-2H3,(H3,15,17,18)/b16-10- |
| InChIKey | OSCSUBAVXLMZGN-YBEGLDIGSA-N |
| XLogP | 2.27 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|