About 2-ethenyl-6-methyl-1,3-diazinan-4-one
2-ethenyl-6-methyl-1,3-diazinan-4-one (PubChem CID 76820095) has the molecular formula C7H12N2O
and a molecular weight of 140.19 g/mol. Its IUPAC name is 2-ethenyl-6-methyl-1,3-diazinan-4-one.
Molecular Properties
| Compound Name | 2-ethenyl-6-methyl-1,3-diazinan-4-one |
| PubChem CID | 76820095 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | 2-ethenyl-6-methyl-1,3-diazinan-4-one |
| SMILES | C=CC1NC(=O)CC(C)N1 |
| InChI | InChI=1S/C7H12N2O/c1-3-6-8-5(2)4-7(10)9-6/h3,5-6,8H,1,4H2,2H3,(H,9,10) |
| InChIKey | UMNWZXAKYGXTRK-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenyl-6-methyl-1,3-diazinan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-6-methyl-1,3-diazinan-4-one?
The IUPAC name of 2-ethenyl-6-methyl-1,3-diazinan-4-one (CID 76820095) is 2-ethenyl-6-methyl-1,3-diazinan-4-one.
What is the SMILES notation for 2-ethenyl-6-methyl-1,3-diazinan-4-one?
The canonical SMILES for 2-ethenyl-6-methyl-1,3-diazinan-4-one is C=CC1NC(=O)CC(C)N1.
What is the InChIKey of 2-ethenyl-6-methyl-1,3-diazinan-4-one?
The InChIKey is UMNWZXAKYGXTRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O/c1-3-6-8-5(2)4-7(10)9-6/h3,5-6,8H,1,4H2,2H3,(H,9,10).
What are the key properties of 2-ethenyl-6-methyl-1,3-diazinan-4-one?
2-ethenyl-6-methyl-1,3-diazinan-4-one has a molecular weight of 140.19 g/mol, XLogP of -0.00, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-6-methyl-1,3-diazinan-4-one is sourced from PubChem (CID 76820095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).