About N-methoxy-1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)propan-1-imine
N-methoxy-1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)propan-1-imine (PubChem CID 76820624) has the molecular formula C10H18N2O
and a molecular weight of 182.27 g/mol. Its IUPAC name is N-methoxy-1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)propan-1-imine.
Molecular Properties
| Compound Name | N-methoxy-1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)propan-1-imine |
| PubChem CID | 76820624 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | N-methoxy-1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)propan-1-imine |
| SMILES | CCC(=NOC)C1=CCN(C)CC1 |
| InChI | InChI=1S/C10H18N2O/c1-4-10(11-13-3)9-5-7-12(2)8-6-9/h5H,4,6-8H2,1-3H3 |
| InChIKey | LLKPCGVDAGTDGM-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methoxy-1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)propan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methoxy-1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)propan-1-imine?
The IUPAC name of N-methoxy-1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)propan-1-imine (CID 76820624) is N-methoxy-1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)propan-1-imine.
What is the SMILES notation for N-methoxy-1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)propan-1-imine?
The canonical SMILES for N-methoxy-1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)propan-1-imine is CCC(=NOC)C1=CCN(C)CC1.
What is the InChIKey of N-methoxy-1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)propan-1-imine?
The InChIKey is LLKPCGVDAGTDGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O/c1-4-10(11-13-3)9-5-7-12(2)8-6-9/h5H,4,6-8H2,1-3H3.
What are the key properties of N-methoxy-1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)propan-1-imine?
N-methoxy-1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)propan-1-imine has a molecular weight of 182.27 g/mol, XLogP of 1.66, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methoxy-1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)propan-1-imine is sourced from PubChem (CID 76820624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).