C21H25Cl2N5O3 — CID 76821064
6-(3-chloro-4-propan-2-yloxyanilino)-1-[(6-chloro-3-pyridinyl)methyl]-3-propan-2-yl-1,3,5-triazinane-2,4-dione (PubChem CID 76821064) has the molecular formula C21H25Cl2N5O3 and a molecular weight of 466.37 g/mol. Its IUPAC name is 6-(3-chloro-4-propan-2-yloxyanilino)-1-[(6-chloro-3-pyridinyl)methyl]-3-propan-2-yl-1,3,5-triazinane-2,4-dione.
| Compound Name | 6-(3-chloro-4-propan-2-yloxyanilino)-1-[(6-chloro-3-pyridinyl)methyl]-3-propan-2-yl-1,3,5-triazinane-2,4-dione |
|---|---|
| PubChem CID | 76821064 |
| Molecular Formula | C21H25Cl2N5O3 |
| Molecular Weight | 466.37 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | 6-(3-chloro-4-propan-2-yloxyanilino)-1-[(6-chloro-3-pyridinyl)methyl]-3-propan-2-yl-1,3,5-triazinane-2,4-dione |
| SMILES | CC(C)Oc1ccc(NC2NC(=O)N(C(C)C)C(=O)N2Cc2ccc(Cl)nc2)cc1Cl |
| InChI | InChI=1S/C21H25Cl2N5O3/c1-12(2)28-20(29)26-19(25-15-6-7-17(16(22)9-15)31-13(3)4)27(21(28)30)11-14-5-8-18(23)24-10-14/h5-10,12-13,19,25H,11H2,1-4H3,(H,26,29) |
| InChIKey | GNHCVBDCPWAYTM-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.37 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|