C21H24F2N4O4 — CID 76821111
1-[(4-fluorophenyl)methyl]-6-(3-fluoro-4-propan-2-yloxyanilino)-3-(2-hydroxyethyl)-1,3,5-triazinane-2,4-dione (PubChem CID 76821111) has the molecular formula C21H24F2N4O4 and a molecular weight of 434.44 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-6-(3-fluoro-4-propan-2-yloxyanilino)-3-(2-hydroxyethyl)-1,3,5-triazinane-2,4-dione.
| Compound Name | 1-[(4-fluorophenyl)methyl]-6-(3-fluoro-4-propan-2-yloxyanilino)-3-(2-hydroxyethyl)-1,3,5-triazinane-2,4-dione |
|---|---|
| PubChem CID | 76821111 |
| Molecular Formula | C21H24F2N4O4 |
| Molecular Weight | 434.44 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-6-(3-fluoro-4-propan-2-yloxyanilino)-3-(2-hydroxyethyl)-1,3,5-triazinane-2,4-dione |
| SMILES | CC(C)Oc1ccc(NC2NC(=O)N(CCO)C(=O)N2Cc2ccc(F)cc2)cc1F |
| InChI | InChI=1S/C21H24F2N4O4/c1-13(2)31-18-8-7-16(11-17(18)23)24-19-25-20(29)26(9-10-28)21(30)27(19)12-14-3-5-15(22)6-4-14/h3-8,11,13,19,24,28H,9-10,12H2,1-2H3,(H,25,29) |
| InChIKey | AOSYSUKODJUUCT-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|