C19H19ClF2N4O4 — CID 76821162
1-[(4-chlorophenyl)methyl]-6-[4-(difluoromethoxy)anilino]-3-(2-hydroxyethyl)-1,3,5-triazinane-2,4-dione (PubChem CID 76821162) has the molecular formula C19H19ClF2N4O4 and a molecular weight of 440.83 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-6-[4-(difluoromethoxy)anilino]-3-(2-hydroxyethyl)-1,3,5-triazinane-2,4-dione.
| Compound Name | 1-[(4-chlorophenyl)methyl]-6-[4-(difluoromethoxy)anilino]-3-(2-hydroxyethyl)-1,3,5-triazinane-2,4-dione |
|---|---|
| PubChem CID | 76821162 |
| Molecular Formula | C19H19ClF2N4O4 |
| Molecular Weight | 440.83 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-6-[4-(difluoromethoxy)anilino]-3-(2-hydroxyethyl)-1,3,5-triazinane-2,4-dione |
| SMILES | O=C1NC(Nc2ccc(OC(F)F)cc2)N(Cc2ccc(Cl)cc2)C(=O)N1CCO |
| InChI | InChI=1S/C19H19ClF2N4O4/c20-13-3-1-12(2-4-13)11-26-17(24-18(28)25(9-10-27)19(26)29)23-14-5-7-15(8-6-14)30-16(21)22/h1-8,16-17,23,27H,9-11H2,(H,24,28) |
| InChIKey | VWKODOJNRMPTAF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.83 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|