C22H27ClN4O3 — CID 76821207
1-[(4-chlorophenyl)methyl]-3-propan-2-yl-6-(4-propan-2-yloxyanilino)-1,3,5-triazinane-2,4-dione (PubChem CID 76821207) has the molecular formula C22H27ClN4O3 and a molecular weight of 430.94 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-propan-2-yl-6-(4-propan-2-yloxyanilino)-1,3,5-triazinane-2,4-dione.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-propan-2-yl-6-(4-propan-2-yloxyanilino)-1,3,5-triazinane-2,4-dione |
|---|---|
| PubChem CID | 76821207 |
| Molecular Formula | C22H27ClN4O3 |
| Molecular Weight | 430.94 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-propan-2-yl-6-(4-propan-2-yloxyanilino)-1,3,5-triazinane-2,4-dione |
| SMILES | CC(C)Oc1ccc(NC2NC(=O)N(C(C)C)C(=O)N2Cc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H27ClN4O3/c1-14(2)27-21(28)25-20(24-18-9-11-19(12-10-18)30-15(3)4)26(22(27)29)13-16-5-7-17(23)8-6-16/h5-12,14-15,20,24H,13H2,1-4H3,(H,25,28) |
| InChIKey | UOUNLQXZPUAAMH-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.94 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|