C20H21ClF2N4O4 — CID 76821343
1-[(4-chlorophenyl)methyl]-6-[4-(difluoromethoxy)anilino]-3-(3-hydroxypropyl)-1,3,5-triazinane-2,4-dione (PubChem CID 76821343) has the molecular formula C20H21ClF2N4O4 and a molecular weight of 454.86 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-6-[4-(difluoromethoxy)anilino]-3-(3-hydroxypropyl)-1,3,5-triazinane-2,4-dione.
| Compound Name | 1-[(4-chlorophenyl)methyl]-6-[4-(difluoromethoxy)anilino]-3-(3-hydroxypropyl)-1,3,5-triazinane-2,4-dione |
|---|---|
| PubChem CID | 76821343 |
| Molecular Formula | C20H21ClF2N4O4 |
| Molecular Weight | 454.86 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-6-[4-(difluoromethoxy)anilino]-3-(3-hydroxypropyl)-1,3,5-triazinane-2,4-dione |
| SMILES | O=C1NC(Nc2ccc(OC(F)F)cc2)N(Cc2ccc(Cl)cc2)C(=O)N1CCCO |
| InChI | InChI=1S/C20H21ClF2N4O4/c21-14-4-2-13(3-5-14)12-27-18(25-19(29)26(20(27)30)10-1-11-28)24-15-6-8-16(9-7-15)31-17(22)23/h2-9,17-18,24,28H,1,10-12H2,(H,25,29) |
| InChIKey | CIYPWVQNMMUCIO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.86 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|