C27H28F3N5O2 — CID 76821361
1-[[4-(dimethylamino)phenyl]methyl]-3-[(4-methylphenyl)methyl]-6-[3-(trifluoromethyl)anilino]-1,3,5-triazinane-2,4-dione (PubChem CID 76821361) has the molecular formula C27H28F3N5O2 and a molecular weight of 511.55 g/mol. Its IUPAC name is 1-[[4-(dimethylamino)phenyl]methyl]-3-[(4-methylphenyl)methyl]-6-[3-(trifluoromethyl)anilino]-1,3,5-triazinane-2,4-dione.
| Compound Name | 1-[[4-(dimethylamino)phenyl]methyl]-3-[(4-methylphenyl)methyl]-6-[3-(trifluoromethyl)anilino]-1,3,5-triazinane-2,4-dione |
|---|---|
| PubChem CID | 76821361 |
| Molecular Formula | C27H28F3N5O2 |
| Molecular Weight | 511.55 g/mol |
| Exact Mass | 511.22 |
| IUPAC Name | 1-[[4-(dimethylamino)phenyl]methyl]-3-[(4-methylphenyl)methyl]-6-[3-(trifluoromethyl)anilino]-1,3,5-triazinane-2,4-dione |
| SMILES | Cc1ccc(CN2C(=O)NC(Nc3cccc(C(F)(F)F)c3)N(Cc3ccc(N(C)C)cc3)C2=O)cc1 |
| InChI | InChI=1S/C27H28F3N5O2/c1-18-7-9-19(10-8-18)17-35-25(36)32-24(31-22-6-4-5-21(15-22)27(28,29)30)34(26(35)37)16-20-11-13-23(14-12-20)33(2)3/h4-15,24,31H,16-17H2,1-3H3,(H,32,36) |
| InChIKey | PUUCWSKJIBNCSW-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.55 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|