C21H25ClN4O4 — CID 76821375
1-[(4-chlorophenyl)methyl]-6-(4-ethoxyanilino)-3-(3-hydroxypropyl)-1,3,5-triazinane-2,4-dione (PubChem CID 76821375) has the molecular formula C21H25ClN4O4 and a molecular weight of 432.91 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-6-(4-ethoxyanilino)-3-(3-hydroxypropyl)-1,3,5-triazinane-2,4-dione.
| Compound Name | 1-[(4-chlorophenyl)methyl]-6-(4-ethoxyanilino)-3-(3-hydroxypropyl)-1,3,5-triazinane-2,4-dione |
|---|---|
| PubChem CID | 76821375 |
| Molecular Formula | C21H25ClN4O4 |
| Molecular Weight | 432.91 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-6-(4-ethoxyanilino)-3-(3-hydroxypropyl)-1,3,5-triazinane-2,4-dione |
| SMILES | CCOc1ccc(NC2NC(=O)N(CCCO)C(=O)N2Cc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H25ClN4O4/c1-2-30-18-10-8-17(9-11-18)23-19-24-20(28)25(12-3-13-27)21(29)26(19)14-15-4-6-16(22)7-5-15/h4-11,19,23,27H,2-3,12-14H2,1H3,(H,24,28) |
| InChIKey | MGUSGQKDQYPNGY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.91 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|