About bis[3-(2-cyano-2-fluoren-9-ylideneacetyl)oxy-2,2-dimethylpropyl] but-2-enedioate
bis[3-(2-cyano-2-fluoren-9-ylideneacetyl)oxy-2,2-dimethylpropyl] but-2-enedioate (PubChem CID 76823014) has the molecular formula C46H38N2O8
and a molecular weight of 746.82 g/mol. Its IUPAC name is bis[3-(2-cyano-2-fluoren-9-ylideneacetyl)oxy-2,2-dimethylpropyl] but-2-enedioate.
Molecular Properties
| Compound Name | bis[3-(2-cyano-2-fluoren-9-ylideneacetyl)oxy-2,2-dimethylpropyl] but-2-enedioate |
| PubChem CID | 76823014 |
| Molecular Formula | C46H38N2O8 |
| Molecular Weight | 746.82 g/mol |
| Exact Mass | 746.26 |
| IUPAC Name | bis[3-(2-cyano-2-fluoren-9-ylideneacetyl)oxy-2,2-dimethylpropyl] but-2-enedioate |
| SMILES | CC(C)(COC(=O)C=CC(=O)OCC(C)(C)COC(=O)C(C#N)=C1c2ccccc2-c2ccccc21)COC(=O)C(C#N)=C1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C46H38N2O8/c1-45(2,27-55-43(51)37(23-47)41-33-17-9-5-13-29(33)30-14-6-10-18-34(30)41)25-53-39(49)21-22-40(50)54-26-46(3,4)28-56-44(52)38(24-48)42-35-19-11-7-15-31(35)32-16-8-12-20-36(32)42/h5-22H,25-28H2,1-4H3 |
| InChIKey | IHLZMEVPVQGDEX-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 152.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 746.82 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis[3-(2-cyano-2-fluoren-9-ylideneacetyl)oxy-2,2-dimethylpropyl] but-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[3-(2-cyano-2-fluoren-9-ylideneacetyl)oxy-2,2-dimethylpropyl] but-2-enedioate?
The IUPAC name of bis[3-(2-cyano-2-fluoren-9-ylideneacetyl)oxy-2,2-dimethylpropyl] but-2-enedioate (CID 76823014) is bis[3-(2-cyano-2-fluoren-9-ylideneacetyl)oxy-2,2-dimethylpropyl] but-2-enedioate.
What is the SMILES notation for bis[3-(2-cyano-2-fluoren-9-ylideneacetyl)oxy-2,2-dimethylpropyl] but-2-enedioate?
The canonical SMILES for bis[3-(2-cyano-2-fluoren-9-ylideneacetyl)oxy-2,2-dimethylpropyl] but-2-enedioate is CC(C)(COC(=O)C=CC(=O)OCC(C)(C)COC(=O)C(C#N)=C1c2ccccc2-c2ccccc21)COC(=O)C(C#N)=C1c2ccccc2-c2ccccc21.
What is the InChIKey of bis[3-(2-cyano-2-fluoren-9-ylideneacetyl)oxy-2,2-dimethylpropyl] but-2-enedioate?
The InChIKey is IHLZMEVPVQGDEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C46H38N2O8/c1-45(2,27-55-43(51)37(23-47)41-33-17-9-5-13-29(33)30-14-6-10-18-34(30)41)25-53-39(49)21-22-40(50)54-26-46(3,4)28-56-44(52)38(24-48)42-35-19-11-7-15-31(35)32-16-8-12-20-36(32)42/h5-22H,25-28H2,1-4H3.
What are the key properties of bis[3-(2-cyano-2-fluoren-9-ylideneacetyl)oxy-2,2-dimethylpropyl] but-2-enedioate?
bis[3-(2-cyano-2-fluoren-9-ylideneacetyl)oxy-2,2-dimethylpropyl] but-2-enedioate has a molecular weight of 746.82 g/mol, XLogP of 7.78, 12 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for bis[3-(2-cyano-2-fluoren-9-ylideneacetyl)oxy-2,2-dimethylpropyl] but-2-enedioate is sourced from PubChem (CID 76823014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).