C32H43F3N4O2 — CID 76824755
[6-[2,3-dimethyl-4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[4-(trifluoromethyl)phenyl]methanone (PubChem CID 76824755) has the molecular formula C32H43F3N4O2 and a molecular weight of 572.72 g/mol. Its IUPAC name is [6-[2,3-dimethyl-4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[4-(trifluoromethyl)phenyl]methanone.
| Compound Name | [6-[2,3-dimethyl-4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[4-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 76824755 |
| Molecular Formula | C32H43F3N4O2 |
| Molecular Weight | 572.72 g/mol |
| Exact Mass | 572.33 |
| IUPAC Name | [6-[2,3-dimethyl-4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[4-(trifluoromethyl)phenyl]methanone |
| SMILES | Cc1c(OCCCN2CCN(C)CC2)ccc(C2CCCC3CN(C(=O)c4ccc(C(F)(F)F)cc4)CCN32)c1C |
| InChI | InChI=1S/C32H43F3N4O2/c1-23-24(2)30(41-21-5-14-37-17-15-36(3)16-18-37)13-12-28(23)29-7-4-6-27-22-38(19-20-39(27)29)31(40)25-8-10-26(11-9-25)32(33,34)35/h8-13,27,29H,4-7,14-22H2,1-3H3 |
| InChIKey | UIZPLZBHXZYXFT-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 39.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.72 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|