C17H17N3O5 — CID 7682566
(8aS)-7-(1,3-benzodioxole-5-carbonyl)-2-prop-2-enyl-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione (PubChem CID 7682566) has the molecular formula C17H17N3O5 and a molecular weight of 343.34 g/mol. Its IUPAC name is (8aS)-7-(1,3-benzodioxole-5-carbonyl)-2-prop-2-enyl-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione.
| Compound Name | (8aS)-7-(1,3-benzodioxole-5-carbonyl)-2-prop-2-enyl-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione |
|---|---|
| PubChem CID | 7682566 |
| Molecular Formula | C17H17N3O5 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | (8aS)-7-(1,3-benzodioxole-5-carbonyl)-2-prop-2-enyl-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione |
| SMILES | C=CCN1C(=O)[C@@H]2CN(C(=O)c3ccc4c(c3)OCO4)CCN2C1=O |
| InChI | InChI=1S/C17H17N3O5/c1-2-5-20-16(22)12-9-18(6-7-19(12)17(20)23)15(21)11-3-4-13-14(8-11)25-10-24-13/h2-4,8,12H,1,5-7,9-10H2/t12-/m0/s1 |
| InChIKey | JPYRRWDBFOWPEF-LBPRGKRZSA-N |
| XLogP | 0.69 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|