C13H16N4O4S — CID 7682594
(8aS)-7-[(4R)-2-oxo-1,3-thiazolidine-4-carbonyl]-2-prop-2-enyl-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione (PubChem CID 7682594) has the molecular formula C13H16N4O4S and a molecular weight of 324.36 g/mol. Its IUPAC name is (8aS)-7-[(4R)-2-oxo-1,3-thiazolidine-4-carbonyl]-2-prop-2-enyl-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione.
| Compound Name | (8aS)-7-[(4R)-2-oxo-1,3-thiazolidine-4-carbonyl]-2-prop-2-enyl-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione |
|---|---|
| PubChem CID | 7682594 |
| Molecular Formula | C13H16N4O4S |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | (8aS)-7-[(4R)-2-oxo-1,3-thiazolidine-4-carbonyl]-2-prop-2-enyl-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione |
| SMILES | C=CCN1C(=O)[C@@H]2CN(C(=O)[C@@H]3CSC(=O)N3)CCN2C1=O |
| InChI | InChI=1S/C13H16N4O4S/c1-2-3-17-11(19)9-6-15(4-5-16(9)13(17)21)10(18)8-7-22-12(20)14-8/h2,8-9H,1,3-7H2,(H,14,20)/t8-,9-/m0/s1 |
| InChIKey | NGTRUTTXMAGVCM-IUCAKERBSA-N |
| XLogP | -0.53 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|