About methyl 8-[2,6-difluoro-4-(hydroxyiminomethyl)phenyl]naphthalene-2-carboxylate
methyl 8-[2,6-difluoro-4-(hydroxyiminomethyl)phenyl]naphthalene-2-carboxylate (PubChem CID 76828106) has the molecular formula C19H13F2NO3
and a molecular weight of 341.31 g/mol. Its IUPAC name is methyl 8-[2,6-difluoro-4-(hydroxyiminomethyl)phenyl]naphthalene-2-carboxylate.
Molecular Properties
| Compound Name | methyl 8-[2,6-difluoro-4-(hydroxyiminomethyl)phenyl]naphthalene-2-carboxylate |
| PubChem CID | 76828106 |
| Molecular Formula | C19H13F2NO3 |
| Molecular Weight | 341.31 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | methyl 8-[2,6-difluoro-4-(hydroxyiminomethyl)phenyl]naphthalene-2-carboxylate |
| SMILES | COC(=O)c1ccc2cccc(-c3c(F)cc(C=NO)cc3F)c2c1 |
| InChI | InChI=1S/C19H13F2NO3/c1-25-19(23)13-6-5-12-3-2-4-14(15(12)9-13)18-16(20)7-11(10-22-24)8-17(18)21/h2-10,24H,1H3 |
| InChIKey | DDQNCGDFXOFGBO-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.31 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 8-[2,6-difluoro-4-(hydroxyiminomethyl)phenyl]naphthalene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 8-[2,6-difluoro-4-(hydroxyiminomethyl)phenyl]naphthalene-2-carboxylate?
The IUPAC name of methyl 8-[2,6-difluoro-4-(hydroxyiminomethyl)phenyl]naphthalene-2-carboxylate (CID 76828106) is methyl 8-[2,6-difluoro-4-(hydroxyiminomethyl)phenyl]naphthalene-2-carboxylate.
What is the SMILES notation for methyl 8-[2,6-difluoro-4-(hydroxyiminomethyl)phenyl]naphthalene-2-carboxylate?
The canonical SMILES for methyl 8-[2,6-difluoro-4-(hydroxyiminomethyl)phenyl]naphthalene-2-carboxylate is COC(=O)c1ccc2cccc(-c3c(F)cc(C=NO)cc3F)c2c1.
What is the InChIKey of methyl 8-[2,6-difluoro-4-(hydroxyiminomethyl)phenyl]naphthalene-2-carboxylate?
The InChIKey is DDQNCGDFXOFGBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13F2NO3/c1-25-19(23)13-6-5-12-3-2-4-14(15(12)9-13)18-16(20)7-11(10-22-24)8-17(18)21/h2-10,24H,1H3.
What are the key properties of methyl 8-[2,6-difluoro-4-(hydroxyiminomethyl)phenyl]naphthalene-2-carboxylate?
methyl 8-[2,6-difluoro-4-(hydroxyiminomethyl)phenyl]naphthalene-2-carboxylate has a molecular weight of 341.31 g/mol, XLogP of 4.38, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 8-[2,6-difluoro-4-(hydroxyiminomethyl)phenyl]naphthalene-2-carboxylate is sourced from PubChem (CID 76828106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).