C21H18N4O — CID 76834882
5-(2-pyridin-2-ylethynyl)-2,8,12-triazatetracyclo[8.7.0.03,8.012,16]heptadeca-1(10),2,4,6-tetraen-9-one (PubChem CID 76834882) has the molecular formula C21H18N4O and a molecular weight of 342.40 g/mol. Its IUPAC name is 5-(2-pyridin-2-ylethynyl)-2,8,12-triazatetracyclo[8.7.0.03,8.012,16]heptadeca-1(10),2,4,6-tetraen-9-one.
| Compound Name | 5-(2-pyridin-2-ylethynyl)-2,8,12-triazatetracyclo[8.7.0.03,8.012,16]heptadeca-1(10),2,4,6-tetraen-9-one |
|---|---|
| PubChem CID | 76834882 |
| Molecular Formula | C21H18N4O |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 5-(2-pyridin-2-ylethynyl)-2,8,12-triazatetracyclo[8.7.0.03,8.012,16]heptadeca-1(10),2,4,6-tetraen-9-one |
| SMILES | O=c1c2c(nc3cc(C#Cc4ccccn4)ccn13)CC1CCCN1C2 |
| InChI | InChI=1S/C21H18N4O/c26-21-18-14-24-10-3-5-17(24)13-19(18)23-20-12-15(8-11-25(20)21)6-7-16-4-1-2-9-22-16/h1-2,4,8-9,11-12,17H,3,5,10,13-14H2 |
| InChIKey | LPLQMNPOYSVRBJ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|