About tert-butyl 4-(5-ethoxy-4-fluoro-5-oxopent-3-enyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate
tert-butyl 4-(5-ethoxy-4-fluoro-5-oxopent-3-enyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 76836301) has the molecular formula C17H28FNO5
and a molecular weight of 345.41 g/mol. Its IUPAC name is tert-butyl 4-(5-ethoxy-4-fluoro-5-oxopent-3-enyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-(5-ethoxy-4-fluoro-5-oxopent-3-enyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| PubChem CID | 76836301 |
| Molecular Formula | C17H28FNO5 |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | tert-butyl 4-(5-ethoxy-4-fluoro-5-oxopent-3-enyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CCOC(=O)C(F)=CCCC1COC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H28FNO5/c1-7-22-14(20)13(18)10-8-9-12-11-23-17(5,6)19(12)15(21)24-16(2,3)4/h10,12H,7-9,11H2,1-6H3 |
| InChIKey | GFGNGTHDVGRNCZ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-(5-ethoxy-4-fluoro-5-oxopent-3-enyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-(5-ethoxy-4-fluoro-5-oxopent-3-enyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate?
The IUPAC name of tert-butyl 4-(5-ethoxy-4-fluoro-5-oxopent-3-enyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (CID 76836301) is tert-butyl 4-(5-ethoxy-4-fluoro-5-oxopent-3-enyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
What is the SMILES notation for tert-butyl 4-(5-ethoxy-4-fluoro-5-oxopent-3-enyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate?
The canonical SMILES for tert-butyl 4-(5-ethoxy-4-fluoro-5-oxopent-3-enyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate is CCOC(=O)C(F)=CCCC1COC(C)(C)N1C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 4-(5-ethoxy-4-fluoro-5-oxopent-3-enyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate?
The InChIKey is GFGNGTHDVGRNCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28FNO5/c1-7-22-14(20)13(18)10-8-9-12-11-23-17(5,6)19(12)15(21)24-16(2,3)4/h10,12H,7-9,11H2,1-6H3.
What are the key properties of tert-butyl 4-(5-ethoxy-4-fluoro-5-oxopent-3-enyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate?
tert-butyl 4-(5-ethoxy-4-fluoro-5-oxopent-3-enyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate has a molecular weight of 345.41 g/mol, XLogP of 3.56, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-(5-ethoxy-4-fluoro-5-oxopent-3-enyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate is sourced from PubChem (CID 76836301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).