C27H25N5O7S — CID 76839231
methyl 2-[[3-(2-cyanophenyl)-2-[4-[4-(2-methoxyethoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]propanoyl]amino]-1,3-thiazole-4-carboxylate (PubChem CID 76839231) has the molecular formula C27H25N5O7S and a molecular weight of 563.59 g/mol. Its IUPAC name is methyl 2-[[3-(2-cyanophenyl)-2-[4-[4-(2-methoxyethoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]propanoyl]amino]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[[3-(2-cyanophenyl)-2-[4-[4-(2-methoxyethoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]propanoyl]amino]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 76839231 |
| Molecular Formula | C27H25N5O7S |
| Molecular Weight | 563.59 g/mol |
| Exact Mass | 563.15 |
| IUPAC Name | methyl 2-[[3-(2-cyanophenyl)-2-[4-[4-(2-methoxyethoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]propanoyl]amino]-1,3-thiazole-4-carboxylate |
| SMILES | COCCOc1ccc(C2NC(=O)N(C(Cc3ccccc3C#N)C(=O)Nc3nc(C(=O)OC)cs3)C2=O)cc1 |
| InChI | InChI=1S/C27H25N5O7S/c1-37-11-12-39-19-9-7-16(8-10-19)22-24(34)32(27(36)30-22)21(13-17-5-3-4-6-18(17)14-28)23(33)31-26-29-20(15-40-26)25(35)38-2/h3-10,15,21-22H,11-13H2,1-2H3,(H,30,36)(H,29,31,33) |
| InChIKey | RPZWIMLJWKXSMW-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 159.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.59 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|