C28H42ClN5O5 — CID 76842978
N-[1-(2-chloropyridine-3-carbonyl)piperidin-4-yl]-2-[[2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]amino]-N,3,3-trimethylbutanamide (PubChem CID 76842978) has the molecular formula C28H42ClN5O5 and a molecular weight of 564.13 g/mol. Its IUPAC name is N-[1-(2-chloropyridine-3-carbonyl)piperidin-4-yl]-2-[[2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]amino]-N,3,3-trimethylbutanamide.
| Compound Name | N-[1-(2-chloropyridine-3-carbonyl)piperidin-4-yl]-2-[[2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]amino]-N,3,3-trimethylbutanamide |
|---|---|
| PubChem CID | 76842978 |
| Molecular Formula | C28H42ClN5O5 |
| Molecular Weight | 564.13 g/mol |
| Exact Mass | 563.29 |
| IUPAC Name | N-[1-(2-chloropyridine-3-carbonyl)piperidin-4-yl]-2-[[2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]amino]-N,3,3-trimethylbutanamide |
| SMILES | CN(C(=O)C(NC(=O)C(CC1CCCC1)CN(O)C=O)C(C)(C)C)C1CCN(C(=O)c2cccnc2Cl)CC1 |
| InChI | InChI=1S/C28H42ClN5O5/c1-28(2,3)23(31-25(36)20(17-34(39)18-35)16-19-8-5-6-9-19)27(38)32(4)21-11-14-33(15-12-21)26(37)22-10-7-13-30-24(22)29/h7,10,13,18-21,23,39H,5-6,8-9,11-12,14-17H2,1-4H3,(H,31,36) |
| InChIKey | FCHBWGJCHQJTML-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 123.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.13 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|