About N,N-dimethylmethanamine;yttrium
N,N-dimethylmethanamine;yttrium (PubChem CID 76843357) has the molecular formula C3H9NY
and a molecular weight of 148.02 g/mol. Its IUPAC name is N,N-dimethylmethanamine;yttrium.
Molecular Properties
| Compound Name | N,N-dimethylmethanamine;yttrium |
| PubChem CID | 76843357 |
| Molecular Formula | C3H9NY |
| Molecular Weight | 148.02 g/mol |
| Exact Mass | 147.98 |
| IUPAC Name | N,N-dimethylmethanamine;yttrium |
| SMILES | CN(C)C.[Y] |
| InChI | InChI=1S/C3H9N.Y/c1-4(2)3;/h1-3H3; |
| InChIKey | FUPXYEANHNHJLE-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.02 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-dimethylmethanamine;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylmethanamine;yttrium?
The IUPAC name of N,N-dimethylmethanamine;yttrium (CID 76843357) is N,N-dimethylmethanamine;yttrium.
What is the SMILES notation for N,N-dimethylmethanamine;yttrium?
The canonical SMILES for N,N-dimethylmethanamine;yttrium is CN(C)C.[Y].
What is the InChIKey of N,N-dimethylmethanamine;yttrium?
The InChIKey is FUPXYEANHNHJLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.Y/c1-4(2)3;/h1-3H3;.
What are the key properties of N,N-dimethylmethanamine;yttrium?
N,N-dimethylmethanamine;yttrium has a molecular weight of 148.02 g/mol, XLogP of 0.18, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylmethanamine;yttrium is sourced from PubChem (CID 76843357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).